CAS 18962-61-3 appears in our catalog under these names: Magnesium L-Aspartate Salt, Magnesium aspartate, 95%+,RG, 95%+,RG. Offered by: TRC, Chemat. Available pack sizes: 25g, 50g, 1g, 5g, 1kg, 100g.
Magnesium (2S)-2-aminobutanedioate (CAS 18962-61-3) is a chemical compound with the molecular formula C4H5MgNO4 and a molecular weight of 155.39 g/mol. IUPAC name: magnesium (2S)-2-aminobutanedioate. InChIKey: NFFJLMKHRCXLJO-DKWTVANSSA-L.
| Molecular formula | C4H5MgNO4 |
|---|---|
| Molecular weight | 155.39 g/mol |
| IUPAC name | magnesium (2S)-2-aminobutanedioate |
| InChIKey | NFFJLMKHRCXLJO-DKWTVANSSA-L |
| SMILES | C([C@@H](C(=O)[O-])N)C(=O)[O-].[Mg+2] |
Computed by PubChem (NCBI)