CAS 1896248-59-1 is the registry number for 2-(1-Hydroxyethyl)-3,5-dimethylphenol 95%. Offered by: Ambeed. Available pack sizes: 100mg, 250mg, 1g.
2-(1-hydroxyethyl)-3,5-dimethylphenol (CAS 1896248-59-1) is a chemical compound with the molecular formula C10H14O2 and a molecular weight of 166.22 g/mol. IUPAC name: 2-(1-hydroxyethyl)-3,5-dimethylphenol. InChIKey: HXCGWXDSKDKHGO-UHFFFAOYSA-N.
| Molecular formula | C10H14O2 |
|---|---|
| Molecular weight | 166.22 g/mol |
| IUPAC name | 2-(1-hydroxyethyl)-3,5-dimethylphenol |
| InChIKey | HXCGWXDSKDKHGO-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C(=C1)O)C(C)O)C |
Computed by PubChem (NCBI)