Products 189633-66-7
CAS 189633-66-7 is the registry number for C-(2,3,4-Tri-O-acetyl-1-hydroxy-b-D-galactopyranosyl)formamide. Offered by: Biosynth. Available pack sizes: 1g.
[(3R,4R,5S,6R)-4,5-diacetyloxy-6-carbamoyl-6-hydroxyoxan-3-yl] acetate (CAS 189633-66-7) is a chemical compound with the molecular formula C12H17NO9 and a molecular weight of 319.26 g/mol. IUPAC name: [(3R,4R,5S,6R)-4,5-diacetyloxy-6-carbamoyl-6-hydroxyoxan-3-yl] acetate. InChIKey: CTBHGAOUGPZNHT-MWGHHZFTSA-N.
| Molecular formula | C12H17NO9 |
|---|---|
| Molecular weight | 319.26 g/mol |
| IUPAC name | [(3R,4R,5S,6R)-4,5-diacetyloxy-6-carbamoyl-6-hydroxyoxan-3-yl] acetate |
| InChIKey | CTBHGAOUGPZNHT-MWGHHZFTSA-N |
| SMILES | CC(=O)O[C@@H]1CO[C@]([C@H]([C@@H]1OC(=O)C)OC(=O)C)(C(=O)N)O |
Computed by PubChem (NCBI)