CAS 18967-31-2 appears in our catalog under these names: Perbromophenyl methacrylate, 98% +(stabilized with MEHQ), PENTABROMOPHENYL METHACRYLATE, 96%, Pentabromophenyl methacrylate, ≥95%, ≥95%. Offered by: AmBeed, Sigma-Aldrich, Chemat. Available pack sizes: 5g, 1g.
(2,3,4,5,6-pentabromophenyl) 2-methylprop-2-enoate (CAS 18967-31-2) is a chemical compound with the molecular formula C10H5Br5O2 and a molecular weight of 556.7 g/mol. IUPAC name: (2,3,4,5,6-pentabromophenyl) 2-methylprop-2-enoate. InChIKey: OFZRSOGEOFHZKS-UHFFFAOYSA-N.
| Molecular formula | C10H5Br5O2 |
|---|---|
| Molecular weight | 556.7 g/mol |
| IUPAC name | (2,3,4,5,6-pentabromophenyl) 2-methylprop-2-enoate |
| InChIKey | OFZRSOGEOFHZKS-UHFFFAOYSA-N |
| SMILES | CC(=C)C(=O)OC1=C(C(=C(C(=C1Br)Br)Br)Br)Br |
Computed by PubChem (NCBI)