CAS 18968-14-4 is the registry number for D-(+)Glucuronic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 25g, 500g, 100g, 5g, 1g.
Beta-D-galacturonic acid is a D-galactopyranuronic acid with a beta-configuration at the anomeric center. It is a conjugate acid of a beta-D-galacturonate.
Source: ChEBI
| Molecular formula | C6H10O7 |
|---|---|
| Molecular weight | 194.14 g/mol |
| IUPAC name | (2S,3R,4S,5R,6R)-3,4,5,6-tetrahydroxyoxane-2-carboxylic acid |
| InChIKey | AEMOLEFTQBMNLQ-DTEWXJGMSA-N |
| SMILES | [C@@H]1([C@H]([C@H](O[C@H]([C@@H]1O)O)C(=O)O)O)O |
Computed by PubChem (NCBI)