Products 189681-71-8
CAS 189681-71-8 appears in our catalog under these names: Aplindore Fumarate/ 100%, Aplindore (fumarate), Aplindore fumarate. Offered by: TargetMol, MedChemExpress, Chemat. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 10 mg, 1 mg.
(2S)-2-[(benzylamino)methyl]-2,3,7,9-tetrahydro-[1,4]dioxino[2,3-e]indol-8-one;(E)-but-2-enedioic acid (CAS 189681-71-8) is a chemical compound with the molecular formula C22H22N2O7 and a molecular weight of 426.4 g/mol. IUPAC name: (2S)-2-[(benzylamino)methyl]-2,3,7,9-tetrahydro-[1,4]dioxino[2,3-e]indol-8-one;(E)-but-2-enedioic acid. InChIKey: GELJVTSEGKGLDF-QDSMGTAFSA-N.
| Molecular formula | C22H22N2O7 |
|---|---|
| Molecular weight | 426.4 g/mol |
| IUPAC name | (2S)-2-[(benzylamino)methyl]-2,3,7,9-tetrahydro-[1,4]dioxino[2,3-e]indol-8-one;(E)-but-2-enedioic acid |
| InChIKey | GELJVTSEGKGLDF-QDSMGTAFSA-N |
| SMILES | C1[C@@H](OC2=C(O1)C=CC3=C2CC(=O)N3)CNCC4=CC=CC=C4.C(=C/C(=O)O)\C(=O)O |
Computed by PubChem (NCBI)