Products 1897061-50-5
CAS 1897061-50-5 is the registry number for 6-Bromo-2-fluoro-3,4-dimethoxybenzoic acid, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
6-bromo-2-fluoro-3,4-dimethoxybenzoic acid (CAS 1897061-50-5) is a chemical compound with the molecular formula C9H8BrFO4 and a molecular weight of 279.06 g/mol. IUPAC name: 6-bromo-2-fluoro-3,4-dimethoxybenzoic acid. InChIKey: WXSGRYVJPJCHIL-UHFFFAOYSA-N.
| Molecular formula | C9H8BrFO4 |
|---|---|
| Molecular weight | 279.06 g/mol |
| IUPAC name | 6-bromo-2-fluoro-3,4-dimethoxybenzoic acid |
| InChIKey | WXSGRYVJPJCHIL-UHFFFAOYSA-N |
| SMILES | COC1=CC(=C(C(=C1OC)F)C(=O)O)Br |
Computed by PubChem (NCBI)