CAS 1897432-67-5 is the registry number for 2-(4-(2-Azidoethoxy)phenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. Offered by: Biosynth. Available pack sizes: 1g.
2-[4-(2-azidoethoxy)phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 1897432-67-5) is a chemical compound with the molecular formula C14H20BN3O3 and a molecular weight of 289.14 g/mol. IUPAC name: 2-[4-(2-azidoethoxy)phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. InChIKey: BHSQQZROHZCKJW-UHFFFAOYSA-N.
| Molecular formula | C14H20BN3O3 |
|---|---|
| Molecular weight | 289.14 g/mol |
| IUPAC name | 2-[4-(2-azidoethoxy)phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| InChIKey | BHSQQZROHZCKJW-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC=C(C=C2)OCCN=[N+]=[N-] |
Computed by PubChem (NCBI)