Products 1897454-97-5
CAS 1897454-97-5 is the registry number for tert-Butyl 5-(trifluoroacetamido)indazole-1-carboxylate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg, 100mg.
Tert-butyl 5-[(2,2,2-trifluoroacetyl)amino]indazole-1-carboxylate (CAS 1897454-97-5) is a chemical compound with the molecular formula C14H14F3N3O3 and a molecular weight of 329.27 g/mol. IUPAC name: tert-butyl 5-[(2,2,2-trifluoroacetyl)amino]indazole-1-carboxylate. InChIKey: NFQCRBFGQLQUBS-UHFFFAOYSA-N.
| Molecular formula | C14H14F3N3O3 |
|---|---|
| Molecular weight | 329.27 g/mol |
| IUPAC name | tert-butyl 5-[(2,2,2-trifluoroacetyl)amino]indazole-1-carboxylate |
| InChIKey | NFQCRBFGQLQUBS-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1C2=C(C=C(C=C2)NC(=O)C(F)(F)F)C=N1 |
Computed by PubChem (NCBI)