CAS 189756-77-2 is the registry number for Methyl 5-formyl-3-(trifluoromethyl)thiophene-2-carboxylate, 97%. Offered by: AmBeed. Available pack sizes: 1g.
Methyl 5-formyl-3-(trifluoromethyl)thiophene-2-carboxylate (CAS 189756-77-2) is a chemical compound with the molecular formula C8H5F3O3S and a molecular weight of 238.19 g/mol. IUPAC name: methyl 5-formyl-3-(trifluoromethyl)thiophene-2-carboxylate. InChIKey: ZPLZSGUMLATIOW-UHFFFAOYSA-N.
| Molecular formula | C8H5F3O3S |
|---|---|
| Molecular weight | 238.19 g/mol |
| IUPAC name | methyl 5-formyl-3-(trifluoromethyl)thiophene-2-carboxylate |
| InChIKey | ZPLZSGUMLATIOW-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C=C(S1)C=O)C(F)(F)F |
Computed by PubChem (NCBI)