CAS 1897681-51-4 is the registry number for 1-(1,1-difluoro-2-methylpropyl)-3-methylbenzene, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
1-(1,1-difluoro-2-methylpropyl)-3-methylbenzene (CAS 1897681-51-4) is a chemical compound with the molecular formula C11H14F2 and a molecular weight of 184.23 g/mol. IUPAC name: 1-(1,1-difluoro-2-methylpropyl)-3-methylbenzene. InChIKey: BNZYVTOFSCRECZ-UHFFFAOYSA-N.
| Molecular formula | C11H14F2 |
|---|---|
| Molecular weight | 184.23 g/mol |
| IUPAC name | 1-(1,1-difluoro-2-methylpropyl)-3-methylbenzene |
| InChIKey | BNZYVTOFSCRECZ-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC=C1)C(C(C)C)(F)F |
Computed by PubChem (NCBI)