Products 1897695-45-2
CAS 1897695-45-2 is the registry number for 3-(4,4-difluorocyclohexyl)benzoic acid, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g.
3-(4,4-difluorocyclohexyl)benzoic acid (CAS 1897695-45-2) is a chemical compound with the molecular formula C13H14F2O2 and a molecular weight of 240.25 g/mol. IUPAC name: 3-(4,4-difluorocyclohexyl)benzoic acid. InChIKey: PKZIUUMASFKFIK-UHFFFAOYSA-N.
| Molecular formula | C13H14F2O2 |
|---|---|
| Molecular weight | 240.25 g/mol |
| IUPAC name | 3-(4,4-difluorocyclohexyl)benzoic acid |
| InChIKey | PKZIUUMASFKFIK-UHFFFAOYSA-N |
| SMILES | C1CC(CCC1C2=CC(=CC=C2)C(=O)O)(F)F |
Computed by PubChem (NCBI)
Synonyms:
3-(4,4-Difluorocyclohexyl)benzoic acid