CAS 18977-33-8 appears in our catalog under these names: 2,6-Bis(3,4-dimethoxybenzylidene)cyclohexanone, 95+%, 2,6-Bis-(3,4-dimethoxyphenylmethylene)cyclohexanone. Offered by: Chemat Brand, TRC. Available pack sizes: on request, 100mg, 250mg, 50mg.
(2E,6E)-2,6-bis[(3,4-dimethoxyphenyl)methylidene]cyclohexan-1-one (CAS 18977-33-8) is a chemical compound with the molecular formula C24H26O5 and a molecular weight of 394.5 g/mol. IUPAC name: (2E,6E)-2,6-bis[(3,4-dimethoxyphenyl)methylidene]cyclohexan-1-one. InChIKey: YOTDZZKBJHGVNA-KLCVKJMQSA-N.
| Molecular formula | C24H26O5 |
|---|---|
| Molecular weight | 394.5 g/mol |
| IUPAC name | (2E,6E)-2,6-bis[(3,4-dimethoxyphenyl)methylidene]cyclohexan-1-one |
| InChIKey | YOTDZZKBJHGVNA-KLCVKJMQSA-N |
| SMILES | COC1=C(C=C(C=C1)/C=C\2/C(=O)/C(=C/C3=CC(=C(C=C3)OC)OC)/CCC2)OC |
Computed by PubChem (NCBI)