Products 1897969-49-1
CAS 1897969-49-1 is the registry number for ethyl 2-(6-bromo-3-chloro-2-fluorophenyl)-2-oxoacetate, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
Ethyl 2-(6-bromo-3-chloro-2-fluorophenyl)-2-oxoacetate (CAS 1897969-49-1) is a chemical compound with the molecular formula C10H7BrClFO3 and a molecular weight of 309.51 g/mol. IUPAC name: ethyl 2-(6-bromo-3-chloro-2-fluorophenyl)-2-oxoacetate. InChIKey: ANFGTFQWTYHHEQ-UHFFFAOYSA-N.
| Molecular formula | C10H7BrClFO3 |
|---|---|
| Molecular weight | 309.51 g/mol |
| IUPAC name | ethyl 2-(6-bromo-3-chloro-2-fluorophenyl)-2-oxoacetate |
| InChIKey | ANFGTFQWTYHHEQ-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(=O)C1=C(C=CC(=C1F)Cl)Br |
Computed by PubChem (NCBI)