Products 1898-91-5

CAS 1898-91-5 is the registry number for Decafluorocyclohexanone, 95%. Offered by: Combi-blocks, Chemat Brand. Available pack sizes: 1g, 5g, 250mg, on request.

Structural formula: {0} (CAS {1})

2,2,3,3,4,4,5,5,6,6-decafluorocyclohexan-1-one (CAS 1898-91-5) is a chemical compound with the molecular formula C6F10O and a molecular weight of 278.05 g/mol. IUPAC name: 2,2,3,3,4,4,5,5,6,6-decafluorocyclohexan-1-one. InChIKey: YUMDTEARLZOACP-UHFFFAOYSA-N.

Identity
Molecular formulaC6F10O
Molecular weight278.05 g/mol
IUPAC name2,2,3,3,4,4,5,5,6,6-decafluorocyclohexan-1-one
InChIKeyYUMDTEARLZOACP-UHFFFAOYSA-N
SMILESC1(=O)C(C(C(C(C1(F)F)(F)F)(F)F)(F)F)(F)F

Computed by PubChem (NCBI)