CAS 189811-56-1 is the registry number for Acenaphthylene-13C6. Offered by: TRC. Available pack sizes: 25mg.
Acenaphthylene (CAS 189811-56-1) is a chemical compound with the molecular formula C12H8 and a molecular weight of 158.15 g/mol. IUPAC name: acenaphthylene. InChIKey: HXGDTGSAIMULJN-INDGIYAYSA-N.
| Molecular formula | C12H8 |
|---|---|
| Molecular weight | 158.15 g/mol |
| IUPAC name | acenaphthylene |
| InChIKey | HXGDTGSAIMULJN-INDGIYAYSA-N |
| SMILES | C1=C[13C]2=[13C]3C(=C1)C=C[13C]3=[13CH][13CH]=[13CH]2 |
Computed by PubChem (NCBI)