Products 189811-60-7
CAS 189811-60-7 is the registry number for Anthracene-13C6. Offered by: MedChemExpress. Available pack sizes: 1 mg.
Anthracene (CAS 189811-60-7) is a chemical compound with the molecular formula C14H10 and a molecular weight of 184.18 g/mol. IUPAC name: anthracene. InChIKey: MWPLVEDNUUSJAV-LSMJWXKXSA-N.
| Molecular formula | C14H10 |
|---|---|
| Molecular weight | 184.18 g/mol |
| IUPAC name | anthracene |
| InChIKey | MWPLVEDNUUSJAV-LSMJWXKXSA-N |
| SMILES | C1=CC2=C[13C]3=[13CH][13CH]=[13CH][13CH]=[13C]3C=C2C=C1 |
Computed by PubChem (NCBI)