CAS 189822-88-6 is the registry number for 2-(2-(2,3,6-Triazino(5,4-β)indol-3-ylthio)acetylhydrazide. Offered by: Biosynth. Available pack sizes: 5000mg.
2-(5H-[1,2,4]triazino[5,6-b]indol-3-ylsulfanyl)acetohydrazide (CAS 189822-88-6) is a chemical compound with the molecular formula C11H10N6OS and a molecular weight of 274.30 g/mol. IUPAC name: 2-(5H-[1,2,4]triazino[5,6-b]indol-3-ylsulfanyl)acetohydrazide. InChIKey: SLDYNRWHWJWHAE-UHFFFAOYSA-N.
| Molecular formula | C11H10N6OS |
|---|---|
| Molecular weight | 274.30 g/mol |
| IUPAC name | 2-(5H-[1,2,4]triazino[5,6-b]indol-3-ylsulfanyl)acetohydrazide |
| InChIKey | SLDYNRWHWJWHAE-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C3=C(N2)N=C(N=N3)SCC(=O)NN |
Computed by PubChem (NCBI)