CAS 189955-89-3 is the registry number for 3-Hydroxy-5,5-dimethyl-4-(4-(methylsulfonyl)phenyl)-2(5H)-furanone. Offered by: TRC. Available pack sizes: 100mg.
3-hydroxy-5,5-dimethyl-4-(4-methylsulfonylphenyl)furan-2-one (CAS 189955-89-3) is a chemical compound with the molecular formula C13H14O5S and a molecular weight of 282.31 g/mol. IUPAC name: 3-hydroxy-5,5-dimethyl-4-(4-methylsulfonylphenyl)furan-2-one. InChIKey: WIPWTSYHKQQKJC-UHFFFAOYSA-N.
| Molecular formula | C13H14O5S |
|---|---|
| Molecular weight | 282.31 g/mol |
| IUPAC name | 3-hydroxy-5,5-dimethyl-4-(4-methylsulfonylphenyl)furan-2-one |
| InChIKey | WIPWTSYHKQQKJC-UHFFFAOYSA-N |
| SMILES | CC1(C(=C(C(=O)O1)O)C2=CC=C(C=C2)S(=O)(=O)C)C |
Computed by PubChem (NCBI)