CAS 18996-36-6 appears in our catalog under these names: Sodium 3-carboxybenzoate 95%, Sodium 3-carboxybenzoate, 95%, 95%. Offered by: Ambeed, Chemat. Available pack sizes: 250mg, 1g, 5g.
Sodium 3-carboxybenzoate (CAS 18996-36-6) is a chemical compound with the molecular formula C8H5NaO4 and a molecular weight of 188.11 g/mol. IUPAC name: sodium 3-carboxybenzoate. InChIKey: GJTNGKDEAATFNA-UHFFFAOYSA-M.
| Molecular formula | C8H5NaO4 |
|---|---|
| Molecular weight | 188.11 g/mol |
| IUPAC name | sodium 3-carboxybenzoate |
| InChIKey | GJTNGKDEAATFNA-UHFFFAOYSA-M |
| SMILES | C1=CC(=CC(=C1)C(=O)[O-])C(=O)O.[Na+] |
Computed by PubChem (NCBI)