CAS 190060-72-1 is the registry number for 4-(Benzyloxy)-2-fluoroaniline, 95%. Offered by: Combi-blocks, Chemat Brand. Available pack sizes: 5g, 1g, on request.
2-fluoro-4-phenylmethoxyaniline (CAS 190060-72-1) is a chemical compound with the molecular formula C13H12FNO and a molecular weight of 217.24 g/mol. IUPAC name: 2-fluoro-4-phenylmethoxyaniline. InChIKey: SDMVHDKRUHLVKO-UHFFFAOYSA-N.
| Molecular formula | C13H12FNO |
|---|---|
| Molecular weight | 217.24 g/mol |
| IUPAC name | 2-fluoro-4-phenylmethoxyaniline |
| InChIKey | SDMVHDKRUHLVKO-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC2=CC(=C(C=C2)N)F |
Computed by PubChem (NCBI)