CAS 19011-77-9 is the registry number for N1-(2-Hydroxyethyl) Flurazepam Hydrochloride. Offered by: TRC, Biosynth. Available pack sizes: 25mg, 50mg.
7-chloro-5-(2-fluorophenyl)-1-(2-hydroxyethyl)-3H-1,4-benzodiazepin-2-one;hydrochloride (CAS 19011-77-9) is a chemical compound with the molecular formula C17H15Cl2FN2O2 and a molecular weight of 369.2 g/mol. IUPAC name: 7-chloro-5-(2-fluorophenyl)-1-(2-hydroxyethyl)-3H-1,4-benzodiazepin-2-one;hydrochloride. InChIKey: HDBYLDSSFKRVAL-UHFFFAOYSA-N.
| Molecular formula | C17H15Cl2FN2O2 |
|---|---|
| Molecular weight | 369.2 g/mol |
| IUPAC name | 7-chloro-5-(2-fluorophenyl)-1-(2-hydroxyethyl)-3H-1,4-benzodiazepin-2-one;hydrochloride |
| InChIKey | HDBYLDSSFKRVAL-UHFFFAOYSA-N |
| SMILES | C1C(=O)N(C2=C(C=C(C=C2)Cl)C(=N1)C3=CC=CC=C3F)CCO.Cl |
Computed by PubChem (NCBI)