CAS 190190-49-9 appears in our catalog under these names: Boc-(r)-3-amino-4-(1-naphthyl)-butyric acid, 95%, (R)–3–(Boc–amino)–4–(1–naphthyl)butyric acid, Boc-(R)-3-Amino-4-(1-naphthyl)-butyric acid, 98%, 98%, Boc-(1-naphthyl)-D-b-homoalanine, 97%. Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem. Available pack sizes: 250mg, 5g, 1g, 100mg.
(3R)-3-[(2-methylpropan-2-yl)oxycarbonylamino]-4-naphthalen-1-ylbutanoic acid (CAS 190190-49-9) is a chemical compound with the molecular formula C19H23NO4 and a molecular weight of 329.4 g/mol. IUPAC name: (3R)-3-[(2-methylpropan-2-yl)oxycarbonylamino]-4-naphthalen-1-ylbutanoic acid. InChIKey: JXDXPRAUFACOHG-OAHLLOKOSA-N.
| Molecular formula | C19H23NO4 |
|---|---|
| Molecular weight | 329.4 g/mol |
| IUPAC name | (3R)-3-[(2-methylpropan-2-yl)oxycarbonylamino]-4-naphthalen-1-ylbutanoic acid |
| InChIKey | JXDXPRAUFACOHG-OAHLLOKOSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@H](CC1=CC=CC2=CC=CC=C21)CC(=O)O |
Computed by PubChem (NCBI)