CAS 1902168-17-5 appears in our catalog under these names: Azobenzene-4,4'-diboronic Acid, (E)–(Diazene–1,2–diylbis(4,1–phenylene))diboronic acid. Offered by: TRC, GLPBio. Available pack sizes: 100mg, 25mg.
[4-[(4-boronophenyl)diazenyl]phenyl]boronic acid (CAS 1902168-17-5) is a chemical compound with the molecular formula C12H12B2N2O4 and a molecular weight of 269.9 g/mol. IUPAC name: [4-[(4-boronophenyl)diazenyl]phenyl]boronic acid. InChIKey: SPJQNBILZYROPH-UHFFFAOYSA-N.
| Molecular formula | C12H12B2N2O4 |
|---|---|
| Molecular weight | 269.9 g/mol |
| IUPAC name | [4-[(4-boronophenyl)diazenyl]phenyl]boronic acid |
| InChIKey | SPJQNBILZYROPH-UHFFFAOYSA-N |
| SMILES | B(C1=CC=C(C=C1)N=NC2=CC=C(C=C2)B(O)O)(O)O |
Computed by PubChem (NCBI)