Products 1902219-46-8

CAS 1902219-46-8 is the registry number for rac-(1R,2R)-2-(Oxolan-2-yl)cyclopropane-1-carboxylic acid. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.

Structural formula: {0} (CAS {1})

Cis-(1R,2R)-2-(oxolan-2-yl)cyclopropane-1-carboxylic acid (CAS 1902219-46-8) is a chemical compound with the molecular formula C8H12O3 and a molecular weight of 156.18 g/mol. IUPAC name: cis-(1R,2R)-2-(oxolan-2-yl)cyclopropane-1-carboxylic acid. InChIKey: YCNDRFSHDFNOFP-CQMSUOBXSA-N.

Identity
Molecular formulaC8H12O3
Molecular weight156.18 g/mol
IUPAC namecis-(1R,2R)-2-(oxolan-2-yl)cyclopropane-1-carboxylic acid
InChIKeyYCNDRFSHDFNOFP-CQMSUOBXSA-N
SMILESC1CC(OC1)[C@@H]2C[C@H]2C(=O)O

Computed by PubChem (NCBI)