Products 190262-92-1

CAS 190262-92-1 is the registry number for 3,7-Dibutyl-2,3,6,7-tetrahydro-1h-purine-2,6-dione, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg.

Structural formula: {0} (CAS {1})

3,7-dibutylpurine-2,6-dione (CAS 190262-92-1) is a chemical compound with the molecular formula C13H20N4O2 and a molecular weight of 264.32 g/mol. IUPAC name: 3,7-dibutylpurine-2,6-dione. InChIKey: KCQXVIHJFHPNBO-UHFFFAOYSA-N.

Identity
Molecular formulaC13H20N4O2
Molecular weight264.32 g/mol
IUPAC name3,7-dibutylpurine-2,6-dione
InChIKeyKCQXVIHJFHPNBO-UHFFFAOYSA-N
SMILESCCCCN1C=NC2=C1C(=O)NC(=O)N2CCCC

Computed by PubChem (NCBI)