CAS 1902954-87-3 appears in our catalog under these names: Abeprazan HCl, Abeprazan hydrochloride, Abeprazan hydrochloride/ 98.62% (existing batch purity), Abeprazan hydrochloride, Abeprazan HCl 99%. Offered by: Chemat Brand, TRC, TargetMol, GLPBio, Ambeed. Available pack sizes: on request, 250mg, 1mg, 5mg, 10mg, 25mg, 50mg, 100mg.
1-[5-(2,4-difluorophenyl)-1-(3-fluorophenyl)sulfonyl-4-methoxypyrrol-3-yl]-N-methylmethanamine;hydrochloride (CAS 1902954-87-3) is a chemical compound with the molecular formula C19H18ClF3N2O3S and a molecular weight of 446.9 g/mol. IUPAC name: 1-[5-(2,4-difluorophenyl)-1-(3-fluorophenyl)sulfonyl-4-methoxypyrrol-3-yl]-N-methylmethanamine;hydrochloride. InChIKey: BOHTZYBQQDVIRI-UHFFFAOYSA-N.
| Molecular formula | C19H18ClF3N2O3S |
|---|---|
| Molecular weight | 446.9 g/mol |
| IUPAC name | 1-[5-(2,4-difluorophenyl)-1-(3-fluorophenyl)sulfonyl-4-methoxypyrrol-3-yl]-N-methylmethanamine;hydrochloride |
| InChIKey | BOHTZYBQQDVIRI-UHFFFAOYSA-N |
| SMILES | CNCC1=CN(C(=C1OC)C2=C(C=C(C=C2)F)F)S(=O)(=O)C3=CC=CC(=C3)F.Cl |
Computed by PubChem (NCBI)