Products 1902957-11-2
CAS 1902957-11-2 is the registry number for rel-tert-Butyl ((3R,4R)-4-cyanopyrrolidin-3-yl)carbamate, >95%. Offered by: Chemat. Available pack sizes: 50mg.
Tert-butyl N-[(3S,4S)-4-cyanopyrrolidin-3-yl]carbamate (CAS 1902957-11-2) is a chemical compound with the molecular formula C10H17N3O2 and a molecular weight of 211.26 g/mol. IUPAC name: tert-butyl N-[(3S,4S)-4-cyanopyrrolidin-3-yl]carbamate. InChIKey: UATHSXZKAWKUKG-JGVFFNPUSA-N.
| Molecular formula | C10H17N3O2 |
|---|---|
| Molecular weight | 211.26 g/mol |
| IUPAC name | tert-butyl N-[(3S,4S)-4-cyanopyrrolidin-3-yl]carbamate |
| InChIKey | UATHSXZKAWKUKG-JGVFFNPUSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@@H]1CNC[C@@H]1C#N |
Computed by PubChem (NCBI)