CAS 1903007-82-8 appears in our catalog under these names: (1S)-(-)-Alpha-Pinene-D3, (-)-a-Pinene-10,10,10-d3, 99 atom % D, min 97% Chemical Purity. Offered by: TRC, CDN. Available pack sizes: 10mg, 25mg, 5mg, 0,01g.
(1S,5S)-6,6-dimethyl-2-(trideuteriomethyl)bicyclo[3.1.1]hept-2-ene (CAS 1903007-82-8) is a chemical compound with the molecular formula C10H16 and a molecular weight of 139.25 g/mol. IUPAC name: (1S,5S)-6,6-dimethyl-2-(trideuteriomethyl)bicyclo[3.1.1]hept-2-ene. InChIKey: GRWFGVWFFZKLTI-UTFMOTILSA-N.
| Molecular formula | C10H16 |
|---|---|
| Molecular weight | 139.25 g/mol |
| IUPAC name | (1S,5S)-6,6-dimethyl-2-(trideuteriomethyl)bicyclo[3.1.1]hept-2-ene |
| InChIKey | GRWFGVWFFZKLTI-UTFMOTILSA-N |
| SMILES | [2H]C([2H])([2H])C1=CC[C@H]2C[C@@H]1C2(C)C |
Computed by PubChem (NCBI)