Products 19031-56-2
CAS 19031-56-2 appears in our catalog under these names: Pimelic Acid-d4, >95% (HPLC), Heptanedioic-2,2,6,6-d4 Acid, 98 atom % D, min 98% Chemical Purity, Pimelic acid-d4. Offered by: TRC, CDN, MedChemExpress. Available pack sizes: 100mg, 10mg, 50mg, 1g, 0,5g, 10 mg, 100 mg, 50 mg.
2,2,6,6-tetradeuterioheptanedioic acid (CAS 19031-56-2) is a chemical compound with the molecular formula C7H12O4 and a molecular weight of 164.19 g/mol. IUPAC name: 2,2,6,6-tetradeuterioheptanedioic acid. InChIKey: WLJVNTCWHIRURA-CQOLUAMGSA-N.
| Molecular formula | C7H12O4 |
|---|---|
| Molecular weight | 164.19 g/mol |
| IUPAC name | 2,2,6,6-tetradeuterioheptanedioic acid |
| InChIKey | WLJVNTCWHIRURA-CQOLUAMGSA-N |
| SMILES | [2H]C([2H])(CCCC([2H])([2H])C(=O)O)C(=O)O |
Computed by PubChem (NCBI)