CAS 1903422-81-0 is the registry number for rac-(1R,2R)-2-(2-Aminoethyl)cyclohexan-1-ol. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
Trans-(1S,2S)-2-(2-aminoethyl)cyclohexan-1-ol (CAS 1903422-81-0) is a chemical compound with the molecular formula C8H17NO and a molecular weight of 143.23 g/mol. IUPAC name: trans-(1S,2S)-2-(2-aminoethyl)cyclohexan-1-ol. InChIKey: AWJXWDOCXRXZPR-YUMQZZPRSA-N.
| Molecular formula | C8H17NO |
|---|---|
| Molecular weight | 143.23 g/mol |
| IUPAC name | trans-(1S,2S)-2-(2-aminoethyl)cyclohexan-1-ol |
| InChIKey | AWJXWDOCXRXZPR-YUMQZZPRSA-N |
| SMILES | C1CC[C@@H]([C@@H](C1)CCN)O |
Computed by PubChem (NCBI)