CAS 1903425-56-8 is the registry number for rac-tert-Butyl N-{((1R,2R)-2-aminocyclohexyl)methyl}carbamate. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
Tert-butyl N-[[(1S,2S)-2-aminocyclohexyl]methyl]carbamate (CAS 1903425-56-8) is a chemical compound with the molecular formula C12H24N2O2 and a molecular weight of 228.33 g/mol. IUPAC name: tert-butyl N-[[(1S,2S)-2-aminocyclohexyl]methyl]carbamate. InChIKey: CZEJXQXLKFWTPQ-UWVGGRQHSA-N.
| Molecular formula | C12H24N2O2 |
|---|---|
| Molecular weight | 228.33 g/mol |
| IUPAC name | tert-butyl N-[[(1S,2S)-2-aminocyclohexyl]methyl]carbamate |
| InChIKey | CZEJXQXLKFWTPQ-UWVGGRQHSA-N |
| SMILES | CC(C)(C)OC(=O)NC[C@@H]1CCCC[C@@H]1N |
Computed by PubChem (NCBI)