Products 1903425-56-8

CAS 1903425-56-8 is the registry number for rac-tert-Butyl N-{((1R,2R)-2-aminocyclohexyl)methyl}carbamate. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.

Structural formula: {0} (CAS {1})

Tert-butyl N-[[(1S,2S)-2-aminocyclohexyl]methyl]carbamate (CAS 1903425-56-8) is a chemical compound with the molecular formula C12H24N2O2 and a molecular weight of 228.33 g/mol. IUPAC name: tert-butyl N-[[(1S,2S)-2-aminocyclohexyl]methyl]carbamate. InChIKey: CZEJXQXLKFWTPQ-UWVGGRQHSA-N.

Identity
Molecular formulaC12H24N2O2
Molecular weight228.33 g/mol
IUPAC nametert-butyl N-[[(1S,2S)-2-aminocyclohexyl]methyl]carbamate
InChIKeyCZEJXQXLKFWTPQ-UWVGGRQHSA-N
SMILESCC(C)(C)OC(=O)NC[C@@H]1CCCC[C@@H]1N

Computed by PubChem (NCBI)