CAS 1903431-16-2 is the registry number for Rel-((3R,4S)-4-fluoro-1-methylpyrrolidin-3-yl)methanol, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
[(3R,4S)-4-fluoro-1-methylpyrrolidin-3-yl]methanol (CAS 1903431-16-2) is a chemical compound with the molecular formula C6H12FNO and a molecular weight of 133.16 g/mol. IUPAC name: [(3R,4S)-4-fluoro-1-methylpyrrolidin-3-yl]methanol. InChIKey: HBRJQLSQSFVPHW-PHDIDXHHSA-N.
| Molecular formula | C6H12FNO |
|---|---|
| Molecular weight | 133.16 g/mol |
| IUPAC name | [(3R,4S)-4-fluoro-1-methylpyrrolidin-3-yl]methanol |
| InChIKey | HBRJQLSQSFVPHW-PHDIDXHHSA-N |
| SMILES | CN1C[C@@H]([C@@H](C1)F)CO |
Computed by PubChem (NCBI)