CAS 19036-27-2 is the registry number for 1,4-Bis(brommethyl)-2,5-dichlorobenzene, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
1,4-bis(bromomethyl)-2,5-dichlorobenzene (CAS 19036-27-2) is a chemical compound with the molecular formula C8H6Br2Cl2 and a molecular weight of 332.84 g/mol. IUPAC name: 1,4-bis(bromomethyl)-2,5-dichlorobenzene. InChIKey: UUZPLRRGKQEIMA-UHFFFAOYSA-N.
| Molecular formula | C8H6Br2Cl2 |
|---|---|
| Molecular weight | 332.84 g/mol |
| IUPAC name | 1,4-bis(bromomethyl)-2,5-dichlorobenzene |
| InChIKey | UUZPLRRGKQEIMA-UHFFFAOYSA-N |
| SMILES | C1=C(C(=CC(=C1Cl)CBr)Cl)CBr |
Computed by PubChem (NCBI)