Products 1903832-78-9
CAS 1903832-78-9 is the registry number for Rel-(1R,3R)-3-fluorocyclopentane-1-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Trans-(1R,3R)-3-fluorocyclopentane-1-carboxylic acid (CAS 1903832-78-9) is a chemical compound with the molecular formula C6H9FO2 and a molecular weight of 132.13 g/mol. IUPAC name: trans-(1R,3R)-3-fluorocyclopentane-1-carboxylic acid. InChIKey: HMWIEXZISHZBTQ-RFZPGFLSSA-N.
| Molecular formula | C6H9FO2 |
|---|---|
| Molecular weight | 132.13 g/mol |
| IUPAC name | trans-(1R,3R)-3-fluorocyclopentane-1-carboxylic acid |
| InChIKey | HMWIEXZISHZBTQ-RFZPGFLSSA-N |
| SMILES | C1C[C@H](C[C@@H]1C(=O)O)F |
Computed by PubChem (NCBI)