Products 19040-72-3

CAS 19040-72-3 is the registry number for 2-(7,8-Dihydroxy-2-oxo-2H-chromen-4-yl)acetic acid, 95%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

2-(7,8-dihydroxy-2-oxochromen-4-yl)acetic acid (CAS 19040-72-3) is a chemical compound with the molecular formula C11H8O6 and a molecular weight of 236.18 g/mol. IUPAC name: 2-(7,8-dihydroxy-2-oxochromen-4-yl)acetic acid. InChIKey: LNRFNPKOQGRTFS-UHFFFAOYSA-N.

Identity
Molecular formulaC11H8O6
Molecular weight236.18 g/mol
IUPAC name2-(7,8-dihydroxy-2-oxochromen-4-yl)acetic acid
InChIKeyLNRFNPKOQGRTFS-UHFFFAOYSA-N
SMILESC1=CC(=C(C2=C1C(=CC(=O)O2)CC(=O)O)O)O

Computed by PubChem (NCBI)