Products 190436-32-9
CAS 190436-32-9 is the registry number for (4-(4-(tert-butyl)phenyl)(2,5-thiazolyl))phenylamine. Offered by: Biosynth. Available pack sizes: 250mg.
4-(4-tert-butylphenyl)-N-phenyl-1,3-thiazol-2-amine (CAS 190436-32-9) is a chemical compound with the molecular formula C19H20N2S and a molecular weight of 308.4 g/mol. IUPAC name: 4-(4-tert-butylphenyl)-N-phenyl-1,3-thiazol-2-amine. InChIKey: YDVWFUNSFXAZSQ-UHFFFAOYSA-N.
| Molecular formula | C19H20N2S |
|---|---|
| Molecular weight | 308.4 g/mol |
| IUPAC name | 4-(4-tert-butylphenyl)-N-phenyl-1,3-thiazol-2-amine |
| InChIKey | YDVWFUNSFXAZSQ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=CC=C(C=C1)C2=CSC(=N2)NC3=CC=CC=C3 |
Computed by PubChem (NCBI)