CAS 19046-94-7 is the registry number for H-Phe-NHNH-Z · TFA. Offered by: Creative Peptides. Available pack sizes: 1g, 5g.
Benzyl N-[[(2S)-2-amino-3-phenylpropanoyl]amino]carbamate;2,2,2-trifluoroacetic acid (CAS 19046-94-7) is a chemical compound with the molecular formula C19H20F3N3O5 and a molecular weight of 427.4 g/mol. IUPAC name: benzyl N-[[(2S)-2-amino-3-phenylpropanoyl]amino]carbamate;2,2,2-trifluoroacetic acid. InChIKey: FIVBNOLPHKMLLF-RSAXXLAASA-N.
| Molecular formula | C19H20F3N3O5 |
|---|---|
| Molecular weight | 427.4 g/mol |
| IUPAC name | benzyl N-[[(2S)-2-amino-3-phenylpropanoyl]amino]carbamate;2,2,2-trifluoroacetic acid |
| InChIKey | FIVBNOLPHKMLLF-RSAXXLAASA-N |
| SMILES | C1=CC=C(C=C1)C[C@@H](C(=O)NNC(=O)OCC2=CC=CC=C2)N.C(=O)(C(F)(F)F)O |
Computed by PubChem (NCBI)