CAS 1905395-21-2 appears in our catalog under these names: Ethane-1,1,2,2-tetrayltetrakis(benzene-4,1-diyl)tetraboronic acid, 98%, 98%, (Ethene–1,1,2,2–tetrayltetrakis(benzene–4,1–diyl))tetraboronic acid, (Ethene-1,1,2,2-tetrayltetrakis(benzene-4,1-diyl))tetraboronic acid, 98%. Offered by: Chemat, GLPBio, Fluorochem, Ambeed. Available pack sizes: 100mg, 250mg, 1g, 5g.
[4-[1,2,2-tris(4-boronophenyl)ethenyl]phenyl]boronic acid (CAS 1905395-21-2) is a chemical compound with the molecular formula C26H24B4O8 and a molecular weight of 507.7 g/mol. IUPAC name: [4-[1,2,2-tris(4-boronophenyl)ethenyl]phenyl]boronic acid. InChIKey: VVGLYAVPCBSDDN-UHFFFAOYSA-N.
| Molecular formula | C26H24B4O8 |
|---|---|
| Molecular weight | 507.7 g/mol |
| IUPAC name | [4-[1,2,2-tris(4-boronophenyl)ethenyl]phenyl]boronic acid |
| InChIKey | VVGLYAVPCBSDDN-UHFFFAOYSA-N |
| SMILES | B(C1=CC=C(C=C1)C(=C(C2=CC=C(C=C2)B(O)O)C3=CC=C(C=C3)B(O)O)C4=CC=C(C=C4)B(O)O)(O)O |
Computed by PubChem (NCBI)