CAS 1906-95-2 appears in our catalog under these names: Diethyl 2-(5-bromopentyl)malonate, 95%, 95%, Diethyl 2-(5-bromopentyl)malonate 95%, Diethyl 2-(5-bromopentyl) Malonate, (5-Bromopentyl)malonic acid diethyl ester, 95%, Diethyl (5–Bromopentyl)malonate. Offered by: Chemat, Ambeed, Chemat Brand, Combi-blocks, GLPBio. Available pack sizes: 1g, 5g, 25g, on request.
Diethyl 2-(5-bromopentyl)propanedioate (CAS 1906-95-2) is a chemical compound with the molecular formula C12H21BrO4 and a molecular weight of 309.20 g/mol. IUPAC name: diethyl 2-(5-bromopentyl)propanedioate. InChIKey: JZCAZGWJCVMTTQ-UHFFFAOYSA-N.
| Molecular formula | C12H21BrO4 |
|---|---|
| Molecular weight | 309.20 g/mol |
| IUPAC name | diethyl 2-(5-bromopentyl)propanedioate |
| InChIKey | JZCAZGWJCVMTTQ-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(CCCCCBr)C(=O)OCC |
Computed by PubChem (NCBI)