CAS 190601-22-0 appears in our catalog under these names: Landiolol Impurity 5, Landiolol Impurity 12, Landiolol Impurity 7, ONO-SA 246, 4-[(2S)-2-Hydroxy-3-[[2-[(4-morpholinylcarbonyl)amino]ethyl]amino]propoxy]benzenepropanoic acid, 99%, 99%. Offered by: Chemat Brand, Hubei YoungXin, TRC, Chemat, Fluorochem. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg, 250mg.
3-[4-[(2S)-2-hydroxy-3-[2-(morpholine-4-carbonylamino)ethylamino]propoxy]phenyl]propanoic acid (CAS 190601-22-0) is a chemical compound with the molecular formula C19H29N3O6 and a molecular weight of 395.4 g/mol. IUPAC name: 3-[4-[(2S)-2-hydroxy-3-[2-(morpholine-4-carbonylamino)ethylamino]propoxy]phenyl]propanoic acid. InChIKey: VZVQHRFHVTZVSV-INIZCTEOSA-N.
| Molecular formula | C19H29N3O6 |
|---|---|
| Molecular weight | 395.4 g/mol |
| IUPAC name | 3-[4-[(2S)-2-hydroxy-3-[2-(morpholine-4-carbonylamino)ethylamino]propoxy]phenyl]propanoic acid |
| InChIKey | VZVQHRFHVTZVSV-INIZCTEOSA-N |
| SMILES | C1COCCN1C(=O)NCCNC[C@@H](COC2=CC=C(C=C2)CCC(=O)O)O |
Computed by PubChem (NCBI)