Products 19064-26-7
CAS 19064-26-7 appears in our catalog under these names: 2-Chloro-n-(2,6-difluorophenyl)acetamide, 95%, 2-Chloro-N-(2,6-difluorophenyl)acetamide. Offered by: Combi-blocks, Fluorochem. Available pack sizes: 10g, 5g, 1g, 250mg, 2.5g.
2-chloro-N-(2,6-difluorophenyl)acetamide (CAS 19064-26-7) is a chemical compound with the molecular formula C8H6ClF2NO and a molecular weight of 205.59 g/mol. IUPAC name: 2-chloro-N-(2,6-difluorophenyl)acetamide. InChIKey: KGKTXGFDPWHUBR-UHFFFAOYSA-N.
| Molecular formula | C8H6ClF2NO |
|---|---|
| Molecular weight | 205.59 g/mol |
| IUPAC name | 2-chloro-N-(2,6-difluorophenyl)acetamide |
| InChIKey | KGKTXGFDPWHUBR-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)F)NC(=O)CCl)F |
Computed by PubChem (NCBI)