CAS 190648-99-8 is the registry number for O-(4-Bromo-2-fluorophenyl) dimethylcarbamothioate, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 25g, 5g, 1g.
O-(4-bromo-2-fluorophenyl) N,N-dimethylcarbamothioate (CAS 190648-99-8) is a chemical compound with the molecular formula C9H9BrFNOS and a molecular weight of 278.14 g/mol. IUPAC name: O-(4-bromo-2-fluorophenyl) N,N-dimethylcarbamothioate. InChIKey: ONIVRSHXEFYTEM-UHFFFAOYSA-N.
| Molecular formula | C9H9BrFNOS |
|---|---|
| Molecular weight | 278.14 g/mol |
| IUPAC name | O-(4-bromo-2-fluorophenyl) N,N-dimethylcarbamothioate |
| InChIKey | ONIVRSHXEFYTEM-UHFFFAOYSA-N |
| SMILES | CN(C)C(=S)OC1=C(C=C(C=C1)Br)F |
Computed by PubChem (NCBI)