Products 190648-99-8

CAS 190648-99-8 is the registry number for O-(4-Bromo-2-fluorophenyl) dimethylcarbamothioate, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 25g, 5g, 1g.

Structural formula: {0} (CAS {1})

O-(4-bromo-2-fluorophenyl) N,N-dimethylcarbamothioate (CAS 190648-99-8) is a chemical compound with the molecular formula C9H9BrFNOS and a molecular weight of 278.14 g/mol. IUPAC name: O-(4-bromo-2-fluorophenyl) N,N-dimethylcarbamothioate. InChIKey: ONIVRSHXEFYTEM-UHFFFAOYSA-N.

Identity
Molecular formulaC9H9BrFNOS
Molecular weight278.14 g/mol
IUPAC nameO-(4-bromo-2-fluorophenyl) N,N-dimethylcarbamothioate
InChIKeyONIVRSHXEFYTEM-UHFFFAOYSA-N
SMILESCN(C)C(=S)OC1=C(C=C(C=C1)Br)F

Computed by PubChem (NCBI)