CAS 190653-73-7 appears in our catalog under these names: N2-((1R,2S)-2-Aminocyclohexyl)-N6-(3-chlorophenyl)-9-ethyl-9H-purine-2,6-diamine, 95%, 95%, CGP-74514, 98.02%. Offered by: Chemat, MedChemExpress. Available pack sizes: 1mg, 5mg, 25mg, 50 mg, 10 mg, 25 mg, 100 mg, 5 mg.
2-N-[(1R,2S)-2-aminocyclohexyl]-6-N-(3-chlorophenyl)-9-ethylpurine-2,6-diamine (CAS 190653-73-7) is a chemical compound with the molecular formula C19H24ClN7 and a molecular weight of 385.9 g/mol. IUPAC name: 2-N-[(1R,2S)-2-aminocyclohexyl]-6-N-(3-chlorophenyl)-9-ethylpurine-2,6-diamine. InChIKey: UTBSBSOBZHXMHI-LSDHHAIUSA-N.
| Molecular formula | C19H24ClN7 |
|---|---|
| Molecular weight | 385.9 g/mol |
| IUPAC name | 2-N-[(1R,2S)-2-aminocyclohexyl]-6-N-(3-chlorophenyl)-9-ethylpurine-2,6-diamine |
| InChIKey | UTBSBSOBZHXMHI-LSDHHAIUSA-N |
| SMILES | CCN1C=NC2=C(N=C(N=C21)N[C@@H]3CCCC[C@@H]3N)NC4=CC(=CC=C4)Cl |
Computed by PubChem (NCBI)