CAS 19072-57-2 appears in our catalog under these names: 1,1-DIETHYL-2,6-DIMETHYLPIPERIDINIUM BROMIDE, 95%, 95%, 1,1-Diethyl-2,6-dimethylpiperidin-1-ium bromide, 95%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g.
1,1-diethyl-2,6-dimethylpiperidin-1-ium bromide (CAS 19072-57-2) is a chemical compound with the molecular formula C11H24BrN and a molecular weight of 250.22 g/mol. IUPAC name: 1,1-diethyl-2,6-dimethylpiperidin-1-ium bromide. InChIKey: JEUPZKBFJZDULG-UHFFFAOYSA-M.
| Molecular formula | C11H24BrN |
|---|---|
| Molecular weight | 250.22 g/mol |
| IUPAC name | 1,1-diethyl-2,6-dimethylpiperidin-1-ium bromide |
| InChIKey | JEUPZKBFJZDULG-UHFFFAOYSA-M |
| SMILES | CC[N+]1(C(CCCC1C)C)CC.[Br-] |
Computed by PubChem (NCBI)