CAS 1907685-82-8 is the registry number for L-Carbidopa-3', 4'-Diphosphate. Offered by: TRC. Available pack sizes: 500mg.
(2S)-3-(3,4-diphosphonooxyphenyl)-2-hydrazinyl-2-methylpropanoic acid (CAS 1907685-82-8) is a chemical compound with the molecular formula C10H16N2O10P2 and a molecular weight of 386.19 g/mol. IUPAC name: (2S)-3-(3,4-diphosphonooxyphenyl)-2-hydrazinyl-2-methylpropanoic acid. InChIKey: LYLIRFRNFPSPFI-JTQLQIEISA-N.
| Molecular formula | C10H16N2O10P2 |
|---|---|
| Molecular weight | 386.19 g/mol |
| IUPAC name | (2S)-3-(3,4-diphosphonooxyphenyl)-2-hydrazinyl-2-methylpropanoic acid |
| InChIKey | LYLIRFRNFPSPFI-JTQLQIEISA-N |
| SMILES | C[C@](CC1=CC(=C(C=C1)OP(=O)(O)O)OP(=O)(O)O)(C(=O)O)NN |
Computed by PubChem (NCBI)