CAS 19077-87-3 is the registry number for Europinidin Chloride. Offered by: TRC. Available pack sizes: 25mg.
2-(3,4-dihydroxy-5-methoxyphenyl)-5-methoxychromenylium-3,7-diol (CAS 19077-87-3) is a chemical compound with the molecular formula C17H15O7+ and a molecular weight of 331.30 g/mol. IUPAC name: 2-(3,4-dihydroxy-5-methoxyphenyl)-5-methoxychromenylium-3,7-diol. InChIKey: XJXMPIWHBIOJSH-UHFFFAOYSA-O.
| Molecular formula | C17H15O7+ |
|---|---|
| Molecular weight | 331.30 g/mol |
| IUPAC name | 2-(3,4-dihydroxy-5-methoxyphenyl)-5-methoxychromenylium-3,7-diol |
| InChIKey | XJXMPIWHBIOJSH-UHFFFAOYSA-O |
| SMILES | COC1=CC(=CC(=C1O)O)C2=C(C=C3C(=CC(=CC3=[O+]2)O)OC)O |
Computed by PubChem (NCBI)