Products 190841-57-7
CAS 190841-57-7 is the registry number for RPR107393. Offered by: MedChemExpress. Available pack sizes: Get quote.
3-(4-quinolin-6-ylphenyl)-1-azabicyclo[2.2.2]octan-3-ol;dihydrochloride (CAS 190841-57-7) is a chemical compound with the molecular formula C22H24Cl2N2O and a molecular weight of 403.3 g/mol. IUPAC name: 3-(4-quinolin-6-ylphenyl)-1-azabicyclo[2.2.2]octan-3-ol;dihydrochloride. InChIKey: ALEHEGZTOBQIGC-UHFFFAOYSA-N.
| Molecular formula | C22H24Cl2N2O |
|---|---|
| Molecular weight | 403.3 g/mol |
| IUPAC name | 3-(4-quinolin-6-ylphenyl)-1-azabicyclo[2.2.2]octan-3-ol;dihydrochloride |
| InChIKey | ALEHEGZTOBQIGC-UHFFFAOYSA-N |
| SMILES | C1CN2CCC1C(C2)(C3=CC=C(C=C3)C4=CC5=C(C=C4)N=CC=C5)O.Cl.Cl |
Computed by PubChem (NCBI)