CAS 190842-36-5 is the registry number for YM928. Offered by: MedChemExpress. Available pack sizes: Get quote.
2-(4-chloro-N-methylanilino)pyrido[3,2-e][1,3]thiazin-4-one (CAS 190842-36-5) is a chemical compound with the molecular formula C14H10ClN3OS and a molecular weight of 303.8 g/mol. IUPAC name: 2-(4-chloro-N-methylanilino)pyrido[3,2-e][1,3]thiazin-4-one. InChIKey: RCGOQPBYNHJZCU-UHFFFAOYSA-N.
| Molecular formula | C14H10ClN3OS |
|---|---|
| Molecular weight | 303.8 g/mol |
| IUPAC name | 2-(4-chloro-N-methylanilino)pyrido[3,2-e][1,3]thiazin-4-one |
| InChIKey | RCGOQPBYNHJZCU-UHFFFAOYSA-N |
| SMILES | CN(C1=CC=C(C=C1)Cl)C2=NC(=O)C3=C(S2)N=CC=C3 |
Computed by PubChem (NCBI)