CAS 1908465-88-2 appears in our catalog under these names: 2',3,4-Trifluoro-4'''-propyl-1,1':4',1'':4'',1'''-quaterphenyl, 95%, 95%, 2',3,4-Trifluoro-4'''-propyl-1,1':4',1'':4'',1'''-quaterphenyl, 95%. Offered by: Chemat, Fluorochem, Ambeed. Available pack sizes: 1g, 5g, 25g.
1,2-difluoro-4-[2-fluoro-4-[4-(4-propylphenyl)phenyl]phenyl]benzene (CAS 1908465-88-2) is a chemical compound with the molecular formula C27H21F3 and a molecular weight of 402.4 g/mol. IUPAC name: 1,2-difluoro-4-[2-fluoro-4-[4-(4-propylphenyl)phenyl]phenyl]benzene. InChIKey: SSBQPGYFNMXMFY-UHFFFAOYSA-N.
| Molecular formula | C27H21F3 |
|---|---|
| Molecular weight | 402.4 g/mol |
| IUPAC name | 1,2-difluoro-4-[2-fluoro-4-[4-(4-propylphenyl)phenyl]phenyl]benzene |
| InChIKey | SSBQPGYFNMXMFY-UHFFFAOYSA-N |
| SMILES | CCCC1=CC=C(C=C1)C2=CC=C(C=C2)C3=CC(=C(C=C3)C4=CC(=C(C=C4)F)F)F |
Computed by PubChem (NCBI)